C26H32ClN5O — CID 22334402
1-(3-chloro-4-methylanilino)-N-[3-(4-ethylpiperazin-1-yl)propyl]isoquinoline-4-carboxamide (PubChem CID 22334402) has the molecular formula C26H32ClN5O and a molecular weight of 466.03 g/mol. Its IUPAC name is 1-(3-chloro-4-methylanilino)-N-[3-(4-ethylpiperazin-1-yl)propyl]isoquinoline-4-carboxamide.
| Compound Name | 1-(3-chloro-4-methylanilino)-N-[3-(4-ethylpiperazin-1-yl)propyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22334402 |
| Molecular Formula | C26H32ClN5O |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-(3-chloro-4-methylanilino)-N-[3-(4-ethylpiperazin-1-yl)propyl]isoquinoline-4-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cnc(Nc3ccc(C)c(Cl)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H32ClN5O/c1-3-31-13-15-32(16-14-31)12-6-11-28-26(33)23-18-29-25(22-8-5-4-7-21(22)23)30-20-10-9-19(2)24(27)17-20/h4-5,7-10,17-18H,3,6,11-16H2,1-2H3,(H,28,33)(H,29,30) |
| InChIKey | QAQMCLUDRDVJNF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|