C22H33N3O4 — CID 22422524
N-[3-(dipropylamino)propyl]-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide (PubChem CID 22422524) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-[3-(dipropylamino)propyl]-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22422524 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)c1cn(C)c(=O)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C22H33N3O4/c1-6-10-25(11-7-2)12-8-9-23-21(26)18-15-24(3)22(27)17-14-20(29-5)19(28-4)13-16(17)18/h13-15H,6-12H2,1-5H3,(H,23,26) |
| InChIKey | PRWNGVXMYSTQNH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|