C26H25N3O4S — CID 22423002
N-(2-ethoxyphenyl)-2-[4-(4-methylphenyl)-1-phenylimidazol-2-yl]sulfonylacetamide (PubChem CID 22423002) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[4-(4-methylphenyl)-1-phenylimidazol-2-yl]sulfonylacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[4-(4-methylphenyl)-1-phenylimidazol-2-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 22423002 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[4-(4-methylphenyl)-1-phenylimidazol-2-yl]sulfonylacetamide |
| SMILES | CCOc1ccccc1NC(=O)CS(=O)(=O)c1nc(-c2ccc(C)cc2)cn1-c1ccccc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-3-33-24-12-8-7-11-22(24)27-25(30)18-34(31,32)26-28-23(20-15-13-19(2)14-16-20)17-29(26)21-9-5-4-6-10-21/h4-17H,3,18H2,1-2H3,(H,27,30) |
| InChIKey | RKJOPJHBHIQJIV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |