C17H22N2O4 — CID 22423402
3-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]-1H-indole-2-carboxylic acid (PubChem CID 22423402) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22423402 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]-1H-indole-2-carboxylic acid |
| SMILES | CC(C)OCCCNC(=O)Cc1c(C(=O)O)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2O4/c1-11(2)23-9-5-8-18-15(20)10-13-12-6-3-4-7-14(12)19-16(13)17(21)22/h3-4,6-7,11,19H,5,8-10H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | RPIGDKMTUTWMBP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|