C26H23N3O4S — CID 22424364
2-[3-(furan-2-ylmethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 22424364) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 22424364 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cn1c(=O)n(Cc2ccco2)c(=O)c2sc3ccccc3c21)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H23N3O4S/c30-22(27-14-6-10-18-8-2-1-3-9-18)17-28-23-20-12-4-5-13-21(20)34-24(23)25(31)29(26(28)32)16-19-11-7-15-33-19/h1-5,7-9,11-13,15H,6,10,14,16-17H2,(H,27,30) |
| InChIKey | PZPHYGAIAOYCPB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|