About azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone
azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 22427453) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 22427453 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2cccc(O)c2)on1)N1CCCCCC1 |
| InChI | InChI=1S/C16H18N2O3/c19-13-7-5-6-12(10-13)15-11-14(17-21-15)16(20)18-8-3-1-2-4-9-18/h5-7,10-11,19H,1-4,8-9H2 |
| InChIKey | GESPHSRCKCLDDR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone (CID 22427453) is azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone is O=C(c1cc(-c2cccc(O)c2)on1)N1CCCCCC1.
What is the InChIKey of azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is GESPHSRCKCLDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c19-13-7-5-6-12(10-13)15-11-14(17-21-15)16(20)18-8-3-1-2-4-9-18/h5-7,10-11,19H,1-4,8-9H2.
What are the key properties of azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone?
azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 286.33 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[5-(3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 22427453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).