C25H27N5O3 — CID 22428533
N-[2,4-dioxo-3-(2-phenylethyl)-1H-benzo[g]pteridin-8-yl]heptanamide (PubChem CID 22428533) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[2,4-dioxo-3-(2-phenylethyl)-1H-benzo[g]pteridin-8-yl]heptanamide.
| Compound Name | N-[2,4-dioxo-3-(2-phenylethyl)-1H-benzo[g]pteridin-8-yl]heptanamide |
|---|---|
| PubChem CID | 22428533 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[2,4-dioxo-3-(2-phenylethyl)-1H-benzo[g]pteridin-8-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc2nc3c(=O)n(CCc4ccccc4)c(=O)[nH]c3nc2c1 |
| InChI | InChI=1S/C25H27N5O3/c1-2-3-4-8-11-21(31)26-18-12-13-19-20(16-18)28-23-22(27-19)24(32)30(25(33)29-23)15-14-17-9-6-5-7-10-17/h5-7,9-10,12-13,16H,2-4,8,11,14-15H2,1H3,(H,26,31)(H,28,29,33) |
| InChIKey | SHCILVNCIQBLDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|