C19H26N2O — CID 22428767
8-tert-butyl-3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 22428767) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 8-tert-butyl-3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 8-tert-butyl-3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 22428767 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 8-tert-butyl-3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | Cc1ccc(C2=NC3(CCC(C(C)(C)C)CC3)NC2=O)cc1 |
| InChI | InChI=1S/C19H26N2O/c1-13-5-7-14(8-6-13)16-17(22)21-19(20-16)11-9-15(10-12-19)18(2,3)4/h5-8,15H,9-12H2,1-4H3,(H,21,22) |
| InChIKey | LNKVFXMAAISBPL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |