C30H32N4O3S — CID 22429249
3-(4-ethylphenyl)-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 22429249) has the molecular formula C30H32N4O3S and a molecular weight of 528.68 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-ethylphenyl)-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22429249 |
| Molecular Formula | C30H32N4O3S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 3-(4-ethylphenyl)-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCc1ccc(-n2c(=O)c3c4c(sc3n(CC(=O)N3CCN(c5ccccc5)CC3)c2=O)CCCC4)cc1 |
| InChI | InChI=1S/C30H32N4O3S/c1-2-21-12-14-23(15-13-21)34-28(36)27-24-10-6-7-11-25(24)38-29(27)33(30(34)37)20-26(35)32-18-16-31(17-19-32)22-8-4-3-5-9-22/h3-5,8-9,12-15H,2,6-7,10-11,16-20H2,1H3 |
| InChIKey | QNFZNXCCZDGMLM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |