C27H27N3O4S — CID 22429180
N-(4-ethylphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide (PubChem CID 22429180) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 22429180 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(4-ethylphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2c(=O)n(-c3cccc(OC)c3)c(=O)c3c4c(sc32)CCCC4)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-3-17-11-13-18(14-12-17)28-23(31)16-29-26-24(21-9-4-5-10-22(21)35-26)25(32)30(27(29)33)19-7-6-8-20(15-19)34-2/h6-8,11-15H,3-5,9-10,16H2,1-2H3,(H,28,31) |
| InChIKey | PWMZEWWVHXZHBW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |