C27H25ClN4O5S — CID 46506614
2-[11-acetyl-4-(3-chlorophenyl)-3,5-dioxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-6-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 46506614) has the molecular formula C27H25ClN4O5S and a molecular weight of 553.04 g/mol. Its IUPAC name is 2-[11-acetyl-4-(3-chlorophenyl)-3,5-dioxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-6-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[11-acetyl-4-(3-chlorophenyl)-3,5-dioxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-6-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46506614 |
| Molecular Formula | C27H25ClN4O5S |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 2-[11-acetyl-4-(3-chlorophenyl)-3,5-dioxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-6-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cn2c(=O)n(-c3cccc(Cl)c3)c(=O)c3c4c(sc32)CN(C(C)=O)CC4)cc1 |
| InChI | InChI=1S/C27H25ClN4O5S/c1-3-37-20-9-7-18(8-10-20)29-23(34)15-31-26-24(21-11-12-30(16(2)33)14-22(21)38-26)25(35)32(27(31)36)19-6-4-5-17(28)13-19/h4-10,13H,3,11-12,14-15H2,1-2H3,(H,29,34) |
| InChIKey | MOJWLPHOBYKFKA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |