C21H23N3O5S — CID 20879460
11-acetyl-4-(3,4-dimethoxyphenyl)-6-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione (PubChem CID 20879460) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 11-acetyl-4-(3,4-dimethoxyphenyl)-6-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione.
| Compound Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
|---|---|
| PubChem CID | 20879460 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-ethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
| SMILES | CCn1c(=O)n(-c2ccc(OC)c(OC)c2)c(=O)c2c3c(sc21)CN(C(C)=O)CC3 |
| InChI | InChI=1S/C21H23N3O5S/c1-5-23-20-18(14-8-9-22(12(2)25)11-17(14)30-20)19(26)24(21(23)27)13-6-7-15(28-3)16(10-13)29-4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | DCODVIBBFRWZLK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |