C23H27N3O5S — CID 20879463
11-acetyl-4-(3,4-dimethoxyphenyl)-6-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione (PubChem CID 20879463) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 11-acetyl-4-(3,4-dimethoxyphenyl)-6-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione.
| Compound Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
|---|---|
| PubChem CID | 20879463 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
| SMILES | COc1ccc(-n2c(=O)c3c4c(sc3n(CC(C)C)c2=O)CN(C(C)=O)CC4)cc1OC |
| InChI | InChI=1S/C23H27N3O5S/c1-13(2)11-25-22-20(16-8-9-24(14(3)27)12-19(16)32-22)21(28)26(23(25)29)15-6-7-17(30-4)18(10-15)31-5/h6-7,10,13H,8-9,11-12H2,1-5H3 |
| InChIKey | HGUGFZYBGGNSEF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |