C27H27N3O6S — CID 22589988
11-acetyl-4-(3,4-dimethoxyphenyl)-6-[(3-methoxyphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione (PubChem CID 22589988) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is 11-acetyl-4-(3,4-dimethoxyphenyl)-6-[(3-methoxyphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione.
| Compound Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-[(3-methoxyphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
|---|---|
| PubChem CID | 22589988 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 11-acetyl-4-(3,4-dimethoxyphenyl)-6-[(3-methoxyphenyl)methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dione |
| SMILES | COc1cccc(Cn2c(=O)n(-c3ccc(OC)c(OC)c3)c(=O)c3c4c(sc32)CN(C(C)=O)CC4)c1 |
| InChI | InChI=1S/C27H27N3O6S/c1-16(31)28-11-10-20-23(15-28)37-26-24(20)25(32)30(18-8-9-21(35-3)22(13-18)36-4)27(33)29(26)14-17-6-5-7-19(12-17)34-2/h5-9,12-13H,10-11,14-15H2,1-4H3 |
| InChIKey | JSYZTXOIFUBVPE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |