C28H27N3O7S — CID 22423616
methyl 2-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetyl]amino]benzoate (PubChem CID 22423616) has the molecular formula C28H27N3O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is methyl 2-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 22423616 |
| Molecular Formula | C28H27N3O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | methyl 2-[[2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)Cn1c(=O)n(-c2ccc(OC)cc2OC)c(=O)c2c3c(sc21)CCCC3 |
| InChI | InChI=1S/C28H27N3O7S/c1-36-16-12-13-20(21(14-16)37-2)31-25(33)24-18-9-5-7-11-22(18)39-26(24)30(28(31)35)15-23(32)29-19-10-6-4-8-17(19)27(34)38-3/h4,6,8,10,12-14H,5,7,9,11,15H2,1-3H3,(H,29,32) |
| InChIKey | YOTBLUBBMGNPKI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |