C27H27N3O3S — CID 18829543
2-[2,4-dioxo-3-(1-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 18829543) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[2,4-dioxo-3-(1-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,4-dioxo-3-(1-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18829543 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-[2,4-dioxo-3-(1-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1c(=O)n(C(C)c2ccccc2)c(=O)c2c3c(sc21)CCCC3 |
| InChI | InChI=1S/C27H27N3O3S/c1-17-10-6-8-14-21(17)28-23(31)16-29-26-24(20-13-7-9-15-22(20)34-26)25(32)30(27(29)33)18(2)19-11-4-3-5-12-19/h3-6,8,10-12,14,18H,7,9,13,15-16H2,1-2H3,(H,28,31) |
| InChIKey | HMGKIJCYVAWNEH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |