C26H24ClN3O3S — CID 18829376
N-(2-chlorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide (PubChem CID 18829376) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 18829376 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
| SMILES | O=C(Cn1c(=O)n(CCc2ccccc2)c(=O)c2c3c(sc21)CCCC3)Nc1ccccc1Cl |
| InChI | InChI=1S/C26H24ClN3O3S/c27-19-11-5-6-12-20(19)28-22(31)16-30-25-23(18-10-4-7-13-21(18)34-25)24(32)29(26(30)33)15-14-17-8-2-1-3-9-17/h1-3,5-6,8-9,11-12H,4,7,10,13-16H2,(H,28,31) |
| InChIKey | GUBINGUKVNXWNR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |