C26H23Cl2N3O3S — CID 18829666
N-(3-chloro-4-methylphenyl)-2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide (PubChem CID 18829666) has the molecular formula C26H23Cl2N3O3S and a molecular weight of 528.46 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 18829666 |
| Molecular Formula | C26H23Cl2N3O3S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(=O)n(Cc3ccccc3Cl)c(=O)c3c4c(sc32)CCCC4)cc1Cl |
| InChI | InChI=1S/C26H23Cl2N3O3S/c1-15-10-11-17(12-20(15)28)29-22(32)14-31-25-23(18-7-3-5-9-21(18)35-25)24(33)30(26(31)34)13-16-6-2-4-8-19(16)27/h2,4,6,8,10-12H,3,5,7,9,13-14H2,1H3,(H,29,32) |
| InChIKey | FPCQQYXGAAWFMH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |