C27H26ClN3O3S — CID 18829379
N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide (PubChem CID 18829379) has the molecular formula C27H26ClN3O3S and a molecular weight of 508.04 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 18829379 |
| Molecular Formula | C27H26ClN3O3S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(2-phenylethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(=O)n(CCc3ccccc3)c(=O)c3c4c(sc32)CCCC4)cc1Cl |
| InChI | InChI=1S/C27H26ClN3O3S/c1-17-11-12-19(15-21(17)28)29-23(32)16-31-26-24(20-9-5-6-10-22(20)35-26)25(33)30(27(31)34)14-13-18-7-3-2-4-8-18/h2-4,7-8,11-12,15H,5-6,9-10,13-14,16H2,1H3,(H,29,32) |
| InChIKey | HBALNMAAHJSYDZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |