C28H34N4O5S — CID 22430231
2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-(4-methylpiperidin-1-yl)sulfonylisoquinolin-1-one (PubChem CID 22430231) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-(4-methylpiperidin-1-yl)sulfonylisoquinolin-1-one.
| Compound Name | 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-(4-methylpiperidin-1-yl)sulfonylisoquinolin-1-one |
|---|---|
| PubChem CID | 22430231 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-4-(4-methylpiperidin-1-yl)sulfonylisoquinolin-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3cc(S(=O)(=O)N4CCC(C)CC4)c4ccccc4c3=O)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O5S/c1-21-11-13-32(14-12-21)38(35,36)26-19-31(28(34)25-6-4-3-5-24(25)26)20-27(33)30-17-15-29(16-18-30)22-7-9-23(37-2)10-8-22/h3-10,19,21H,11-18,20H2,1-2H3 |
| InChIKey | MFNJCPWAQWDRBQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|