C30H23N5O3S2 — CID 2243134
2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 2243134) has the molecular formula C30H23N5O3S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 2243134 |
| Molecular Formula | C30H23N5O3S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2-[[3-cyano-4,6-bis(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c(C#N)c(SCC(=O)Nc3nc(-c4ccccc4)ns3)n2)cc1 |
| InChI | InChI=1S/C30H23N5O3S2/c1-37-22-12-8-19(9-13-22)24-16-26(20-10-14-23(38-2)15-11-20)32-29(25(24)17-31)39-18-27(36)33-30-34-28(35-40-30)21-6-4-3-5-7-21/h3-16H,18H2,1-2H3,(H,33,34,35,36) |
| InChIKey | BSNVTIKZOWFEOI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|