C17H16N6O — CID 22431482
N-(2-ethoxyphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine (PubChem CID 22431482) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine.
| Compound Name | N-(2-ethoxyphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 22431482 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(2-ethoxyphenyl)-8-methyltetrazolo[1,5-a]quinoxalin-4-amine |
| SMILES | CCOc1ccccc1Nc1nc2ccc(C)cc2n2nnnc12 |
| InChI | InChI=1S/C17H16N6O/c1-3-24-15-7-5-4-6-13(15)19-16-17-20-21-22-23(17)14-10-11(2)8-9-12(14)18-16/h4-10H,3H2,1-2H3,(H,18,19) |
| InChIKey | BHPOOWUPZSESIG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |