C10H14N4O3 — CID 22433700
1-cyclopentyl-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (PubChem CID 22433700) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
| Compound Name | 1-cyclopentyl-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 22433700 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-cyclopentyl-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| SMILES | O=C(Nc1c[nH]c(=O)[nH]c1=O)NC1CCCC1 |
| InChI | InChI=1S/C10H14N4O3/c15-8-7(5-11-9(16)14-8)13-10(17)12-6-3-1-2-4-6/h5-6H,1-4H2,(H2,12,13,17)(H2,11,14,15,16) |
| InChIKey | HAZGGEZZYWADKP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |