C31H39Cl2N5O2 — CID 22437311
2-[amino(1H-indol-3-yl)methyl]-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)butanamide (PubChem CID 22437311) has the molecular formula C31H39Cl2N5O2 and a molecular weight of 584.59 g/mol. Its IUPAC name is 2-[amino(1H-indol-3-yl)methyl]-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)butanamide.
| Compound Name | 2-[amino(1H-indol-3-yl)methyl]-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 22437311 |
| Molecular Formula | C31H39Cl2N5O2 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 2-[amino(1H-indol-3-yl)methyl]-N-[(3,4-dichlorophenyl)methyl]-N-methyl-3-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)butanamide |
| SMILES | CC(=O)C(C(=O)N(C)Cc1ccc(Cl)c(Cl)c1)(C(N)c1c[nH]c2ccccc12)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C31H39Cl2N5O2/c1-21(39)31(29(34)25-19-35-28-9-5-4-8-24(25)28,30(40)36(2)20-22-10-11-26(32)27(33)18-22)38-16-12-23(13-17-38)37-14-6-3-7-15-37/h4-5,8-11,18-19,23,29,35H,3,6-7,12-17,20,34H2,1-2H3 |
| InChIKey | QSSPDQAAXLSAMZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|