C15H16ClNO2S — CID 22437363
4-(2-chlorophenyl)-2-pentyl-1,3-thiazole-5-carboxylic acid (PubChem CID 22437363) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-pentyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(2-chlorophenyl)-2-pentyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22437363 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(2-chlorophenyl)-2-pentyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCCc1nc(-c2ccccc2Cl)c(C(=O)O)s1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-2-3-4-9-12-17-13(14(20-12)15(18)19)10-7-5-6-8-11(10)16/h5-8H,2-4,9H2,1H3,(H,18,19) |
| InChIKey | RKFOCPITCWIYLB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|