C33H36N2O3 — CID 22443365
4-hexyl-3,3-dimethyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one (PubChem CID 22443365) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-hexyl-3,3-dimethyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one.
| Compound Name | 4-hexyl-3,3-dimethyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one |
|---|---|
| PubChem CID | 22443365 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 4-hexyl-3,3-dimethyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one |
| SMILES | CCCCCCc1cc(OCc2cccc(OCc3ccc4ccccc4n3)c2)cc2c1C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C33H36N2O3/c1-4-5-6-7-13-25-19-28(20-30-31(25)33(2,3)32(36)35-30)37-21-23-11-10-14-27(18-23)38-22-26-17-16-24-12-8-9-15-29(24)34-26/h8-12,14-20H,4-7,13,21-22H2,1-3H3,(H,35,36) |
| InChIKey | BDTGJYKBSILRIJ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|