C27H24N2O3 — CID 22443419
3,3-dimethyl-6-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one (PubChem CID 22443419) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3,3-dimethyl-6-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one.
| Compound Name | 3,3-dimethyl-6-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one |
|---|---|
| PubChem CID | 22443419 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3,3-dimethyl-6-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2cc(OCc3ccc(OCc4ccc5ccccc5n4)cc3)ccc21 |
| InChI | InChI=1S/C27H24N2O3/c1-27(2)23-14-13-22(15-25(23)29-26(27)30)31-16-18-7-11-21(12-8-18)32-17-20-10-9-19-5-3-4-6-24(19)28-20/h3-15H,16-17H2,1-2H3,(H,29,30) |
| InChIKey | WEMGCZWJKJNPLO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |