About 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline
2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline (PubChem CID 21014285) has the molecular formula C26H22N4O2
and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline.
Molecular Properties
| Compound Name | 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline |
| PubChem CID | 21014285 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline |
| SMILES | c1ccc2nc(COc3ccc(COc4ccc(Cc5ncn[nH]5)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C26H22N4O2/c1-2-4-25-21(3-1)9-10-22(29-25)17-32-24-13-7-20(8-14-24)16-31-23-11-5-19(6-12-23)15-26-27-18-28-30-26/h1-14,18H,15-17H2,(H,27,28,30) |
| InChIKey | YJMNRNYYGOZNEP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline?
The IUPAC name of 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline (CID 21014285) is 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline.
What is the SMILES notation for 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline?
The canonical SMILES for 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline is c1ccc2nc(COc3ccc(COc4ccc(Cc5ncn[nH]5)cc4)cc3)ccc2c1.
What is the InChIKey of 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline?
The InChIKey is YJMNRNYYGOZNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N4O2/c1-2-4-25-21(3-1)9-10-22(29-25)17-32-24-13-7-20(8-14-24)16-31-23-11-5-19(6-12-23)15-26-27-18-28-30-26/h1-14,18H,15-17H2,(H,27,28,30).
What are the key properties of 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline?
2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline has a molecular weight of 422.49 g/mol, XLogP of 5.10, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[[4-(1H-1,2,4-triazol-5-ylmethyl)phenoxy]methyl]phenoxy]methyl]quinoline is sourced from PubChem (CID 21014285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).