C17H17N3O — CID 141069718
5-[2-(4-phenylmethoxyphenyl)ethyl]-1H-1,2,4-triazole (PubChem CID 141069718) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-[2-(4-phenylmethoxyphenyl)ethyl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-(4-phenylmethoxyphenyl)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 141069718 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-[2-(4-phenylmethoxyphenyl)ethyl]-1H-1,2,4-triazole |
| SMILES | c1ccc(COc2ccc(CCc3ncn[nH]3)cc2)cc1 |
| InChI | InChI=1S/C17H17N3O/c1-2-4-15(5-3-1)12-21-16-9-6-14(7-10-16)8-11-17-18-13-19-20-17/h1-7,9-10,13H,8,11-12H2,(H,18,19,20) |
| InChIKey | XVCVMSNPKBODIN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |