C23H24N4O — CID 20597850
2-[[4-[2-methyl-4-(1H-1,2,4-triazol-5-yl)butyl]phenoxy]methyl]quinoline (PubChem CID 20597850) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[[4-[2-methyl-4-(1H-1,2,4-triazol-5-yl)butyl]phenoxy]methyl]quinoline.
| Compound Name | 2-[[4-[2-methyl-4-(1H-1,2,4-triazol-5-yl)butyl]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 20597850 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[[4-[2-methyl-4-(1H-1,2,4-triazol-5-yl)butyl]phenoxy]methyl]quinoline |
| SMILES | CC(CCc1ncn[nH]1)Cc1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-17(6-13-23-24-16-25-27-23)14-18-7-11-21(12-8-18)28-15-20-10-9-19-4-2-3-5-22(19)26-20/h2-5,7-12,16-17H,6,13-15H2,1H3,(H,24,25,27) |
| InChIKey | NMOOUPBAILFJKT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |