About 2-cyanobut-3-enoic acid
2-cyanobut-3-enoic acid (PubChem CID 22446665) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is 2-cyanobut-3-enoic acid.
Molecular Properties
| Compound Name | 2-cyanobut-3-enoic acid |
| PubChem CID | 22446665 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | 2-cyanobut-3-enoic acid |
| SMILES | C=CC(C#N)C(=O)O |
| InChI | InChI=1S/C5H5NO2/c1-2-4(3-6)5(7)8/h2,4H,1H2,(H,7,8) |
| InChIKey | FREMWRRNCPNPFR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanobut-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanobut-3-enoic acid?
The IUPAC name of 2-cyanobut-3-enoic acid (CID 22446665) is 2-cyanobut-3-enoic acid.
What is the SMILES notation for 2-cyanobut-3-enoic acid?
The canonical SMILES for 2-cyanobut-3-enoic acid is C=CC(C#N)C(=O)O.
What is the InChIKey of 2-cyanobut-3-enoic acid?
The InChIKey is FREMWRRNCPNPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c1-2-4(3-6)5(7)8/h2,4H,1H2,(H,7,8).
What are the key properties of 2-cyanobut-3-enoic acid?
2-cyanobut-3-enoic acid has a molecular weight of 111.10 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanobut-3-enoic acid is sourced from PubChem (CID 22446665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).