About 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate
1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 22450692) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate.
Molecular Properties
| Compound Name | 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate |
| PubChem CID | 22450692 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCC(OC(=O)C1C2CCC(=O)C21)c1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-2-13(10-6-4-3-5-7-10)19-16(18)15-11-8-9-12(17)14(11)15/h3-7,11,13-15H,2,8-9H2,1H3 |
| InChIKey | WKUPPBAOEQLXGB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate?
The IUPAC name of 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate (CID 22450692) is 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate.
What is the SMILES notation for 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate?
The canonical SMILES for 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate is CCC(OC(=O)C1C2CCC(=O)C21)c1ccccc1.
What is the InChIKey of 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate?
The InChIKey is WKUPPBAOEQLXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O3/c1-2-13(10-6-4-3-5-7-10)19-16(18)15-11-8-9-12(17)14(11)15/h3-7,11,13-15H,2,8-9H2,1H3.
What are the key properties of 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate?
1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropyl 2-oxobicyclo[3.1.0]hexane-6-carboxylate is sourced from PubChem (CID 22450692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).