C29H27N3O3 — CID 22451845
2-[7-[2-(4-carbamimidoylphenyl)ethynyl]-3-oxo-2-(2-phenylethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid (PubChem CID 22451845) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[7-[2-(4-carbamimidoylphenyl)ethynyl]-3-oxo-2-(2-phenylethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid.
| Compound Name | 2-[7-[2-(4-carbamimidoylphenyl)ethynyl]-3-oxo-2-(2-phenylethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22451845 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[7-[2-(4-carbamimidoylphenyl)ethynyl]-3-oxo-2-(2-phenylethyl)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C#Cc2ccc3c(c2)CC(CC(=O)O)C(=O)N(CCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C29H27N3O3/c30-28(31)23-11-8-21(9-12-23)6-7-22-10-13-24-19-32(15-14-20-4-2-1-3-5-20)29(35)26(18-27(33)34)17-25(24)16-22/h1-5,8-13,16,26H,14-15,17-19H2,(H3,30,31)(H,33,34) |
| InChIKey | AZZGHRJTPFSBMK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|