C27H29N5O2 — CID 22451856
N-(4-carbamimidoylphenyl)-N,2-dimethyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carboxamide (PubChem CID 22451856) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N,2-dimethyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carboxamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N,2-dimethyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carboxamide |
|---|---|
| PubChem CID | 22451856 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N,2-dimethyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)C(=O)c2ccc3c(c2)NC(C)C(=O)N(CCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C27H29N5O2/c1-18-26(33)32(15-14-19-6-4-3-5-7-19)17-22-9-8-21(16-24(22)30-18)27(34)31(2)23-12-10-20(11-13-23)25(28)29/h3-13,16,18,30H,14-15,17H2,1-2H3,(H3,28,29) |
| InChIKey | IPLSMRGANVADJP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|