About 2,2-dimethyl-1,3-dihydropyrrole
2,2-dimethyl-1,3-dihydropyrrole (PubChem CID 22455999) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydropyrrole.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dihydropyrrole |
| PubChem CID | 22455999 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydropyrrole |
| SMILES | CC1(C)CC=CN1 |
| InChI | InChI=1S/C6H11N/c1-6(2)4-3-5-7-6/h3,5,7H,4H2,1-2H3 |
| InChIKey | SZNJAJYHMVOXMW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-1,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dihydropyrrole?
The IUPAC name of 2,2-dimethyl-1,3-dihydropyrrole (CID 22455999) is 2,2-dimethyl-1,3-dihydropyrrole.
What is the SMILES notation for 2,2-dimethyl-1,3-dihydropyrrole?
The canonical SMILES for 2,2-dimethyl-1,3-dihydropyrrole is CC1(C)CC=CN1.
What is the InChIKey of 2,2-dimethyl-1,3-dihydropyrrole?
The InChIKey is SZNJAJYHMVOXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-6(2)4-3-5-7-6/h3,5,7H,4H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dihydropyrrole?
2,2-dimethyl-1,3-dihydropyrrole has a molecular weight of 97.16 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dihydropyrrole is sourced from PubChem (CID 22455999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).