C17H27N3O8 — CID 22458029
2-N,5-N-dimethyl-2-N,5-N-bis(1,3,4-trihydroxybutyl)pyridine-2,5-dicarboxamide (PubChem CID 22458029) has the molecular formula C17H27N3O8 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-N,5-N-dimethyl-2-N,5-N-bis(1,3,4-trihydroxybutyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-dimethyl-2-N,5-N-bis(1,3,4-trihydroxybutyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 22458029 |
| Molecular Formula | C17H27N3O8 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-N,5-N-dimethyl-2-N,5-N-bis(1,3,4-trihydroxybutyl)pyridine-2,5-dicarboxamide |
| SMILES | CN(C(=O)c1ccc(C(=O)N(C)C(O)CC(O)CO)nc1)C(O)CC(O)CO |
| InChI | InChI=1S/C17H27N3O8/c1-19(14(25)5-11(23)8-21)16(27)10-3-4-13(18-7-10)17(28)20(2)15(26)6-12(24)9-22/h3-4,7,11-12,14-15,21-26H,5-6,8-9H2,1-2H3 |
| InChIKey | MABCEUKTHDZBIE-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|