C27H27N3O3S — CID 22458313
(E)-N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-3-(3-cyanophenyl)-2-methylprop-2-enamide (PubChem CID 22458313) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is (E)-N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-3-(3-cyanophenyl)-2-methylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-3-(3-cyanophenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22458313 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (E)-N-[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]-3-(3-cyanophenyl)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cccc(C#N)c1)C(=O)Nc1ccc(-c2ccccc2S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-19(16-20-8-7-9-21(17-20)18-28)26(31)29-23-14-12-22(13-15-23)24-10-5-6-11-25(24)34(32,33)30-27(2,3)4/h5-17,30H,1-4H3,(H,29,31)/b19-16+ |
| InChIKey | NRBXGIIGEMAAQO-KNTRCKAVSA-N |
| XLogP | 5.34 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|