C23H30N6O3S — CID 22460095
(E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-[methyl-(1-methylpyrrolidin-3-yl)sulfamoyl]anilino]phenyl]prop-2-enamide (PubChem CID 22460095) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-[methyl-(1-methylpyrrolidin-3-yl)sulfamoyl]anilino]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-[methyl-(1-methylpyrrolidin-3-yl)sulfamoyl]anilino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 22460095 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (E)-N-(diaminomethylidene)-2-methyl-3-[4-[4-[methyl-(1-methylpyrrolidin-3-yl)sulfamoyl]anilino]phenyl]prop-2-enamide |
| SMILES | C/C(=C\c1ccc(Nc2ccc(S(=O)(=O)N(C)C3CCN(C)C3)cc2)cc1)C(=O)N=C(N)N |
| InChI | InChI=1S/C23H30N6O3S/c1-16(22(30)27-23(24)25)14-17-4-6-18(7-5-17)26-19-8-10-21(11-9-19)33(31,32)29(3)20-12-13-28(2)15-20/h4-11,14,20,26H,12-13,15H2,1-3H3,(H4,24,25,27,30)/b16-14+ |
| InChIKey | VWRLUFDTULROFS-JQIJEIRASA-N |
| XLogP | 1.96 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|