C33H70ClNO2 — CID 22463699
9,10-didecoxydecyl(trimethyl)azanium chloride (PubChem CID 22463699) has the molecular formula C33H70ClNO2 and a molecular weight of 548.38 g/mol. Its IUPAC name is 9,10-didecoxydecyl(trimethyl)azanium chloride.
| Compound Name | 9,10-didecoxydecyl(trimethyl)azanium chloride |
|---|---|
| PubChem CID | 22463699 |
| Molecular Formula | C33H70ClNO2 |
| Molecular Weight | 548.38 g/mol |
| Exact Mass | 547.51 |
| IUPAC Name | 9,10-didecoxydecyl(trimethyl)azanium chloride |
| SMILES | CCCCCCCCCCOCC(CCCCCCCC[N+](C)(C)C)OCCCCCCCCCC.[Cl-] |
| InChI | InChI=1S/C33H70NO2.ClH/c1-6-8-10-12-14-18-22-26-30-35-32-33(36-31-27-23-19-15-13-11-9-7-2)28-24-20-16-17-21-25-29-34(3,4)5;/h33H,6-32H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | XHOUEPMAZYWGCP-UHFFFAOYSA-M |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.38 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|