C19H32N2O2 — CID 22464370
tert-butyl N-[1-(2,3-dimethylanilino)hexan-2-yl]carbamate (PubChem CID 22464370) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl N-[1-(2,3-dimethylanilino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,3-dimethylanilino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 22464370 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl N-[1-(2,3-dimethylanilino)hexan-2-yl]carbamate |
| SMILES | CCCCC(CNc1cccc(C)c1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O2/c1-7-8-11-16(21-18(22)23-19(4,5)6)13-20-17-12-9-10-14(2)15(17)3/h9-10,12,16,20H,7-8,11,13H2,1-6H3,(H,21,22) |
| InChIKey | ADQCHZRAISAVTI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |