C15H33NOSi — CID 22466195
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hept-6-en-2-amine (PubChem CID 22466195) has the molecular formula C15H33NOSi and a molecular weight of 271.52 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hept-6-en-2-amine.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hept-6-en-2-amine |
|---|---|
| PubChem CID | 22466195 |
| Molecular Formula | C15H33NOSi |
| Molecular Weight | 271.52 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hept-6-en-2-amine |
| SMILES | C=CCCCC(C)NCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33NOSi/c1-8-9-10-11-14(2)16-12-13-17-18(6,7)15(3,4)5/h8,14,16H,1,9-13H2,2-7H3 |
| InChIKey | IOZBFORLPSKYKP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|