C28H31F4N3O3 — CID 22470168
2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluoroanilino)ethyl]piperidin-4-yl]acetic acid (PubChem CID 22470168) has the molecular formula C28H31F4N3O3 and a molecular weight of 533.57 g/mol. Its IUPAC name is 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluoroanilino)ethyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluoroanilino)ethyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22470168 |
| Molecular Formula | C28H31F4N3O3 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 2-[4-[3-(3-fluoro-6-methoxyquinolin-4-yl)propyl]-1-[2-(2,3,5-trifluoroanilino)ethyl]piperidin-4-yl]acetic acid |
| SMILES | COc1ccc2ncc(F)c(CCCC3(CC(=O)O)CCN(CCNc4cc(F)cc(F)c4F)CC3)c2c1 |
| InChI | InChI=1S/C28H31F4N3O3/c1-38-19-4-5-24-21(15-19)20(23(31)17-34-24)3-2-6-28(16-26(36)37)7-10-35(11-8-28)12-9-33-25-14-18(29)13-22(30)27(25)32/h4-5,13-15,17,33H,2-3,6-12,16H2,1H3,(H,36,37) |
| InChIKey | DSMRQPZVNSCDLT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|