C28H34F3N3O2 — CID 22468615
[4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidin-4-yl]methanol (PubChem CID 22468615) has the molecular formula C28H34F3N3O2 and a molecular weight of 501.59 g/mol. Its IUPAC name is [4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidin-4-yl]methanol.
| Compound Name | [4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 22468615 |
| Molecular Formula | C28H34F3N3O2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | [4-[3-(6-methoxy-3-methylquinolin-4-yl)propyl]-1-[2-(3,4,5-trifluoroanilino)ethyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc2ncc(C)c(CCCC3(CO)CCN(CCNc4cc(F)c(F)c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C28H34F3N3O2/c1-19-17-33-26-6-5-21(36-2)16-23(26)22(19)4-3-7-28(18-35)8-11-34(12-9-28)13-10-32-20-14-24(29)27(31)25(30)15-20/h5-6,14-17,32,35H,3-4,7-13,18H2,1-2H3 |
| InChIKey | UVNCRQMSXOLEMX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|