C25H19Cl4NO3 — CID 22475141
[2,2-bis(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]-piperidin-1-ylmethanone (PubChem CID 22475141) has the molecular formula C25H19Cl4NO3 and a molecular weight of 523.24 g/mol. Its IUPAC name is [2,2-bis(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [2,2-bis(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 22475141 |
| Molecular Formula | C25H19Cl4NO3 |
| Molecular Weight | 523.24 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | [2,2-bis(3,5-dichlorophenyl)-1,3-benzodioxol-5-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)OC(c1cc(Cl)cc(Cl)c1)(c1cc(Cl)cc(Cl)c1)O2)N1CCCCC1 |
| InChI | InChI=1S/C25H19Cl4NO3/c26-18-9-16(10-19(27)13-18)25(17-11-20(28)14-21(29)12-17)32-22-5-4-15(8-23(22)33-25)24(31)30-6-2-1-3-7-30/h4-5,8-14H,1-3,6-7H2 |
| InChIKey | YQKPPXZFPFSGMC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.24 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |