About (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone
(2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 10455267) has the molecular formula C27H28N2O3
and a molecular weight of 428.53 g/mol. Its IUPAC name is (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 10455267 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2ccc3c(c2)OC(c2ccccc2)(c2ccccc2)O3)CC1 |
| InChI | InChI=1S/C27H28N2O3/c1-20(2)28-15-17-29(18-16-28)26(30)21-13-14-24-25(19-21)32-27(31-24,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,19-20H,15-18H2,1-2H3 |
| InChIKey | FZMDXCHIDVGRKQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The IUPAC name of (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone (CID 10455267) is (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone is CC(C)N1CCN(C(=O)c2ccc3c(c2)OC(c2ccccc2)(c2ccccc2)O3)CC1.
What is the InChIKey of (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The InChIKey is FZMDXCHIDVGRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O3/c1-20(2)28-15-17-29(18-16-28)26(30)21-13-14-24-25(19-21)32-27(31-24,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,19-20H,15-18H2,1-2H3.
What are the key properties of (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
(2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone has a molecular weight of 428.53 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-diphenyl-1,3-benzodioxol-5-yl)-(4-propan-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 10455267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).