C27H33NO4 — CID 142857468
(Z)-but-2-ene;(2-but-1-en-2-yl-2-phenyl-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 142857468) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is (Z)-but-2-ene;(2-but-1-en-2-yl-2-phenyl-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (Z)-but-2-ene;(2-but-1-en-2-yl-2-phenyl-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 142857468 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (Z)-but-2-ene;(2-but-1-en-2-yl-2-phenyl-1,3-benzodioxol-5-yl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | C/C=C\C.C=C(CC)C1(c2ccccc2)Oc2ccc(C(=O)N3CCC(O)CC3)cc2O1 |
| InChI | InChI=1S/C23H25NO4.C4H8/c1-3-16(2)23(18-7-5-4-6-8-18)27-20-10-9-17(15-21(20)28-23)22(26)24-13-11-19(25)12-14-24;1-3-4-2/h4-10,15,19,25H,2-3,11-14H2,1H3;3-4H,1-2H3/b;4-3- |
| InChIKey | SDNCKRMSYUTRRD-QGAMPUOQSA-N |
| XLogP | 5.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|