C21H29N3O5S — CID 22475449
benzyl N-amino-N-[6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate (PubChem CID 22475449) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is benzyl N-amino-N-[6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate.
| Compound Name | benzyl N-amino-N-[6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate |
|---|---|
| PubChem CID | 22475449 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | benzyl N-amino-N-[6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate |
| SMILES | COc1ccc(NS(=O)(=O)CCCCCCN(N)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-28-20-13-11-19(12-14-20)23-30(26,27)16-8-3-2-7-15-24(22)21(25)29-17-18-9-5-4-6-10-18/h4-6,9-14,23H,2-3,7-8,15-17,22H2,1H3 |
| InChIKey | NWGGYDCYVWPSAU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|