C21H29N3O5S — CID 69442580
benzyl N-[5-amino-6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate (PubChem CID 69442580) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is benzyl N-[5-amino-6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate.
| Compound Name | benzyl N-[5-amino-6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate |
|---|---|
| PubChem CID | 69442580 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | benzyl N-[5-amino-6-[(4-methoxyphenyl)sulfamoyl]hexyl]carbamate |
| SMILES | COc1ccc(NS(=O)(=O)CC(N)CCCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-28-20-12-10-19(11-13-20)24-30(26,27)16-18(22)9-5-6-14-23-21(25)29-15-17-7-3-2-4-8-17/h2-4,7-8,10-13,18,24H,5-6,9,14-16,22H2,1H3,(H,23,25) |
| InChIKey | MFYLZNREOSZXOJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|