C19H28N2OS — CID 2247660
2-benzylsulfanyl-N'-[(4S)-4-tert-butylcyclohexen-1-yl]acetohydrazide (PubChem CID 2247660) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is 2-benzylsulfanyl-N'-[(4S)-4-tert-butylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-benzylsulfanyl-N'-[(4S)-4-tert-butylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2247660 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-benzylsulfanyl-N'-[(4S)-4-tert-butylcyclohexen-1-yl]acetohydrazide |
| SMILES | CC(C)(C)[C@@H]1CC=C(NNC(=O)CSCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2OS/c1-19(2,3)16-9-11-17(12-10-16)20-21-18(22)14-23-13-15-7-5-4-6-8-15/h4-8,11,16,20H,9-10,12-14H2,1-3H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | SYOUWMIVWOZVRF-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|