C15H12FN3O2 — CID 22477605
3-[6-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propanoic acid (PubChem CID 22477605) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 3-[6-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propanoic acid.
| Compound Name | 3-[6-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propanoic acid |
|---|---|
| PubChem CID | 22477605 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-[6-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(-c2ccc(F)cc2)[nH]c2nccnc12 |
| InChI | InChI=1S/C15H12FN3O2/c16-10-3-1-9(2-4-10)13-11(5-6-12(20)21)14-15(19-13)18-8-7-17-14/h1-4,7-8H,5-6H2,(H,18,19)(H,20,21) |
| InChIKey | YXOCECKDUCUKPX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |